About CID 136674672
CID 136674672 (PubChem CID 136674672) has the molecular formula C9H13Ge
and a molecular weight of 193.81 g/mol.
Molecular Properties
| Compound Name | CID 136674672 |
| PubChem CID | 136674672 |
| Molecular Formula | C9H13Ge |
| Molecular Weight | 193.81 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | — |
| SMILES | Cc1ccc([Ge](C)C)cc1 |
| InChI | InChI=1S/C9H13Ge/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1-3H3 |
| InChIKey | BGYJMXICDIWNBM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.81 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 136674672 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136674672?
The IUPAC name of CID 136674672 (CID 136674672) is not available.
What is the SMILES notation for CID 136674672?
The canonical SMILES for CID 136674672 is Cc1ccc([Ge](C)C)cc1.
What is the InChIKey of CID 136674672?
The InChIKey is BGYJMXICDIWNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Ge/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1-3H3.
What are the key properties of CID 136674672?
CID 136674672 has a molecular weight of 193.81 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136674672 is sourced from PubChem (CID 136674672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).