C22H14N4O5S2-2 — CID 136682914
7-hydroxy-8-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,3-disulfinate (PubChem CID 136682914) has the molecular formula C22H14N4O5S2-2 and a molecular weight of 478.51 g/mol. Its IUPAC name is 7-hydroxy-8-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,3-disulfinate.
| Compound Name | 7-hydroxy-8-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,3-disulfinate |
|---|---|
| PubChem CID | 136682914 |
| Molecular Formula | C22H14N4O5S2-2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 7-hydroxy-8-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,3-disulfinate |
| SMILES | O=S([O-])c1cc(S(=O)[O-])c2c(/N=N/c3ccc(/N=N/c4ccccc4)cc3)c(O)ccc2c1 |
| InChI | InChI=1S/C22H16N4O5S2/c27-19-11-6-14-12-18(32(28)29)13-20(33(30)31)21(14)22(19)26-25-17-9-7-16(8-10-17)24-23-15-4-2-1-3-5-15/h1-13,27H,(H,28,29)(H,30,31)/p-2/b24-23+,26-25+ |
| InChIKey | WJYJYTUITUHMHX-QSZPNPOGSA-L |
| XLogP | 5.85 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|