C22H16MoN5O3S- — CID 136606587
5-amino-4-hydroxy-3,6-bis(phenyldiazenyl)naphthalene-2-sulfinate;molybdenum (PubChem CID 136606587) has the molecular formula C22H16MoN5O3S- and a molecular weight of 526.41 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3,6-bis(phenyldiazenyl)naphthalene-2-sulfinate;molybdenum.
| Compound Name | 5-amino-4-hydroxy-3,6-bis(phenyldiazenyl)naphthalene-2-sulfinate;molybdenum |
|---|---|
| PubChem CID | 136606587 |
| Molecular Formula | C22H16MoN5O3S- |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | 5-amino-4-hydroxy-3,6-bis(phenyldiazenyl)naphthalene-2-sulfinate;molybdenum |
| SMILES | Nc1c(/N=N/c2ccccc2)ccc2cc(S(=O)[O-])c(/N=N/c3ccccc3)c(O)c12.[Mo] |
| InChI | InChI=1S/C22H17N5O3S.Mo/c23-20-17(26-24-15-7-3-1-4-8-15)12-11-14-13-18(31(29)30)21(22(28)19(14)20)27-25-16-9-5-2-6-10-16;/h1-13,28H,23H2,(H,29,30);/p-1/b26-24+,27-25+; |
| InChIKey | GOIKBOYMJXYDKS-PQZHMVGGSA-M |
| XLogP | 6.19 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|