C20H11F7N3NaO5S — CID 136726103
sodium 2,2,3,3,4,4,4-heptafluoro-N-(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)butanimidate (PubChem CID 136726103) has the molecular formula C20H11F7N3NaO5S and a molecular weight of 561.37 g/mol. Its IUPAC name is sodium 2,2,3,3,4,4,4-heptafluoro-N-(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)butanimidate.
| Compound Name | sodium 2,2,3,3,4,4,4-heptafluoro-N-(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)butanimidate |
|---|---|
| PubChem CID | 136726103 |
| Molecular Formula | C20H11F7N3NaO5S |
| Molecular Weight | 561.37 g/mol |
| Exact Mass | 561.02 |
| IUPAC Name | sodium 2,2,3,3,4,4,4-heptafluoro-N-(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)butanimidate |
| SMILES | O=S(=O)(O)c1cc2ccc(/N=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F)cc2c(O)c1/N=N/c1ccccc1.[Na+] |
| InChI | InChI=1S/C20H12F7N3O5S.Na/c21-18(22,19(23,24)20(25,26)27)17(32)28-12-7-6-10-8-14(36(33,34)35)15(16(31)13(10)9-12)30-29-11-4-2-1-3-5-11;/h1-9,31H,(H,28,32)(H,33,34,35);/q;+1/p-1/b30-29+; |
| InChIKey | UBVAQVWLARSPKX-BXGDTPBJSA-M |
| XLogP | 2.43 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|