C13H25N3OS — CID 136748295
2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylacetamide (PubChem CID 136748295) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylacetamide.
| Compound Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 136748295 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C/N=C1/NC(CC)(CC)CS1 |
| InChI | InChI=1S/C13H25N3OS/c1-5-13(6-2)10-18-12(15-13)14-9-11(17)16(7-3)8-4/h5-10H2,1-4H3,(H,14,15) |
| InChIKey | OWNZVRCRVMZINI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|