About CID 136750305
CID 136750305 (PubChem CID 136750305) has the molecular formula C36H16BF15PSi
and a molecular weight of 803.37 g/mol.
Molecular Properties
| Compound Name | CID 136750305 |
| PubChem CID | 136750305 |
| Molecular Formula | C36H16BF15PSi |
| Molecular Weight | 803.37 g/mol |
| Exact Mass | 803.06 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[PH+](c2ccccc2)[Si](c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C36H16BF15PSi/c38-22-19(23(39)29(45)34(50)28(22)44)37(20-24(40)30(46)35(51)31(47)25(20)41,21-26(42)32(48)36(52)33(49)27(21)43)53(16-10-4-1-5-11-16)54(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,53H |
| InChIKey | NCMYXATZCSOUDD-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 803.37 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 136750305 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136750305?
The IUPAC name of CID 136750305 (CID 136750305) is not available.
What is the SMILES notation for CID 136750305?
The canonical SMILES for CID 136750305 is Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[PH+](c2ccccc2)[Si](c2ccccc2)c2ccccc2)c(F)c1F.
What is the InChIKey of CID 136750305?
The InChIKey is NCMYXATZCSOUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H16BF15PSi/c38-22-19(23(39)29(45)34(50)28(22)44)37(20-24(40)30(46)35(51)31(47)25(20)41,21-26(42)32(48)36(52)33(49)27(21)43)53(16-10-4-1-5-11-16)54(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,53H.
What are the key properties of CID 136750305?
CID 136750305 has a molecular weight of 803.37 g/mol, XLogP of 7.09, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136750305 is sourced from PubChem (CID 136750305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).