C72H58N4Si4 — CID 136753240
CID 136753240 (PubChem CID 136753240) has the molecular formula C72H58N4Si4 and a molecular weight of 1091.63 g/mol.
| Compound Name | CID 136753240 |
|---|---|
| PubChem CID | 136753240 |
| Molecular Formula | C72H58N4Si4 |
| Molecular Weight | 1091.63 g/mol |
| Exact Mass | 1090.37 |
| IUPAC Name | — |
| SMILES | C[Si](c1ccccc1)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccc([Si](C)c4ccccc4)cc3)=c3/cc/c([nH]3)=C(\c3ccc([Si](C)c4ccccc4)cc3)C3=N/C(=C(/c4ccc([Si](C)c5ccccc5)cc4)C4=NC2=CC4)C=C3)cc1 |
| InChI | InChI=1S/C72H58N4Si4/c1-77(53-17-9-5-10-18-53)57-33-25-49(26-34-57)69-61-41-43-63(73-61)70(50-27-35-58(36-28-50)78(2)54-19-11-6-12-20-54)65-45-47-67(75-65)72(52-31-39-60(40-32-52)80(4)56-23-15-8-16-24-56)68-48-46-66(76-68)71(64-44-42-62(69)74-64)51-29-37-59(38-30-51)79(3)55-21-13-7-14-22-55/h5-47,73H,48H2,1-4H3/b69-61-,70-63-,71-64-,72-67- |
| InChIKey | ZZAVYPMEVHRKNH-YVWKKYMWSA-N |
| XLogP | 8.95 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.63 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|