C36H22N4O12S8 — CID 136791433
4-[10,15,20-tris(5-sulfothiophen-3-yl)-21,23-dihydroporphyrin-5-yl]thiophene-2-sulfonic acid (PubChem CID 136791433) has the molecular formula C36H22N4O12S8 and a molecular weight of 959.12 g/mol. Its IUPAC name is 4-[10,15,20-tris(5-sulfothiophen-3-yl)-21,23-dihydroporphyrin-5-yl]thiophene-2-sulfonic acid.
| Compound Name | 4-[10,15,20-tris(5-sulfothiophen-3-yl)-21,23-dihydroporphyrin-5-yl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 136791433 |
| Molecular Formula | C36H22N4O12S8 |
| Molecular Weight | 959.12 g/mol |
| Exact Mass | 957.90 |
| IUPAC Name | 4-[10,15,20-tris(5-sulfothiophen-3-yl)-21,23-dihydroporphyrin-5-yl]thiophene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(-c2c3nc(c(-c4csc(S(=O)(=O)O)c4)c4ccc([nH]4)c(-c4csc(S(=O)(=O)O)c4)c4nc(c(-c5csc(S(=O)(=O)O)c5)c5ccc2[nH]5)C=C4)C=C3)cs1 |
| InChI | InChI=1S/C36H22N4O12S8/c41-57(42,43)29-9-17(13-53-29)33-21-1-2-22(37-21)34(18-10-30(54-14-18)58(44,45)46)24-5-6-26(39-24)36(20-12-32(56-16-20)60(50,51)52)28-8-7-27(40-28)35(25-4-3-23(33)38-25)19-11-31(55-15-19)59(47,48)49/h1-16,37,40H,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52)/b33-21-,33-23-,34-22-,34-24-,35-25-,35-27-,36-26-,36-28- |
| InChIKey | NWRLYSDGEPPVIL-AJSIJETNSA-N |
| XLogP | 8.56 |
| TPSA | 274.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.12 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|