C12H19N3 — CID 136839928
7-cyclohexyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine (PubChem CID 136839928) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 7-cyclohexyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine.
| Compound Name | 7-cyclohexyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 136839928 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 7-cyclohexyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine |
| SMILES | c1cn2c(n1)NC(C1CCCCC1)CC2 |
| InChI | InChI=1S/C12H19N3/c1-2-4-10(5-3-1)11-6-8-15-9-7-13-12(15)14-11/h7,9-11H,1-6,8H2,(H,13,14) |
| InChIKey | LSFKUIGHDBYNAD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |