C25H24BrN5O6S — CID 136911765
methyl (2E)-2-(1H-benzimidazol-2-yl)-2-[[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]acetate (PubChem CID 136911765) has the molecular formula C25H24BrN5O6S and a molecular weight of 602.47 g/mol. Its IUPAC name is methyl (2E)-2-(1H-benzimidazol-2-yl)-2-[[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]acetate.
| Compound Name | methyl (2E)-2-(1H-benzimidazol-2-yl)-2-[[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 136911765 |
| Molecular Formula | C25H24BrN5O6S |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | methyl (2E)-2-(1H-benzimidazol-2-yl)-2-[[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]hydrazinylidene]acetate |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(N/N=C(/C(=O)OC)c3nc4ccccc4[nH]3)ccc2OC)cc1Br |
| InChI | InChI=1S/C25H24BrN5O6S/c1-4-37-20-11-10-16(13-17(20)26)31-38(33,34)22-14-15(9-12-21(22)35-2)29-30-23(25(32)36-3)24-27-18-7-5-6-8-19(18)28-24/h5-14,29,31H,4H2,1-3H3,(H,27,28)/b30-23+ |
| InChIKey | YURHZKKKRPNBFN-JJKYIXSRSA-N |
| XLogP | 4.52 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|