C7H9F2IN4O — CID 136979150
4-[(3-amino-2,2-difluoropropyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136979150) has the molecular formula C7H9F2IN4O and a molecular weight of 330.08 g/mol. Its IUPAC name is 4-[(3-amino-2,2-difluoropropyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(3-amino-2,2-difluoropropyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979150 |
| Molecular Formula | C7H9F2IN4O |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 4-[(3-amino-2,2-difluoropropyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | NCC(F)(F)CNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C7H9F2IN4O/c8-7(9,1-11)2-12-5-4(10)6(15)14-3-13-5/h3H,1-2,11H2,(H2,12,13,14,15) |
| InChIKey | ZPDZCMYRYLJQGC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|