C12H20BrN5O6P+ — CID 136991200
9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-7-methyl-3,8-dihydro-2H-purin-6-amine (PubChem CID 136991200) has the molecular formula C12H20BrN5O6P+ and a molecular weight of 441.20 g/mol. Its IUPAC name is 9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-7-methyl-3,8-dihydro-2H-purin-6-amine.
| Compound Name | 9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-7-methyl-3,8-dihydro-2H-purin-6-amine |
|---|---|
| PubChem CID | 136991200 |
| Molecular Formula | C12H20BrN5O6P+ |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-bromo-7-methyl-3,8-dihydro-2H-purin-6-amine |
| SMILES | COC1C(N2C3=C(C(N)=NCN3)N(C)C2Br)O[C@@H]2CO[P+](O)(O)O[C@@H]12 |
| InChI | InChI=1S/C12H20BrN5O6P/c1-17-6-9(14)15-4-16-10(6)18(12(17)13)11-8(21-2)7-5(23-11)3-22-25(19,20)24-7/h5,7-8,11-12,16,19-20H,3-4H2,1-2H3,(H2,14,15)/q+1/t5-,7-,8?,11?,12?/m1/s1 |
| InChIKey | WNGRJCSPENNJLR-KNAKDPNCSA-N |
| XLogP | -1.18 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|