C29H20N6O7S — CID 136995266
3-[[4-[(4-formyloxyphenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-7-[(4-hydroxyphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136995266) has the molecular formula C29H20N6O7S and a molecular weight of 596.58 g/mol. Its IUPAC name is 3-[[4-[(4-formyloxyphenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-7-[(4-hydroxyphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 3-[[4-[(4-formyloxyphenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-7-[(4-hydroxyphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136995266 |
| Molecular Formula | C29H20N6O7S |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | 3-[[4-[(4-formyloxyphenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-7-[(4-hydroxyphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=COc1ccc(/N=N/c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(/N=N/c5ccc(O)cc5)ccc4c3O)cc2)cc1 |
| InChI | InChI=1S/C29H20N6O7S/c36-17-42-25-12-7-22(8-13-25)31-30-19-1-3-20(4-2-19)33-35-28-27(43(39,40)41)16-18-15-23(9-14-26(18)29(28)38)34-32-21-5-10-24(37)11-6-21/h1-17,37-38H,(H,39,40,41)/b31-30+,34-32+,35-33+ |
| InChIKey | HXQKEULAOSXPEW-SVNZJNBPSA-N |
| XLogP | 8.28 |
| TPSA | 195.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|