C15H19FN2O4S — CID 137035080
5-[(4-fluorophenyl)methoxymethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137035080) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methoxymethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 5-[(4-fluorophenyl)methoxymethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137035080 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 5-[(4-fluorophenyl)methoxymethyl]-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C/N=C1/NC2C(OC(COCc3ccc(F)cc3)C(O)C2O)S1 |
| InChI | InChI=1S/C15H19FN2O4S/c1-17-15-18-11-13(20)12(19)10(22-14(11)23-15)7-21-6-8-2-4-9(16)5-3-8/h2-5,10-14,19-20H,6-7H2,1H3,(H,17,18) |
| InChIKey | MEOSAVXRUMPVOM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|