C17H24N2O5 — CID 137184308
(3aR,5R,6S,7R,7aR)-5-[(4-methoxyphenyl)methoxymethyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrole-6,7-diol (PubChem CID 137184308) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-5-[(4-methoxyphenyl)methoxymethyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-5-[(4-methoxyphenyl)methoxymethyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrole-6,7-diol |
|---|---|
| PubChem CID | 137184308 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-5-[(4-methoxyphenyl)methoxymethyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrole-6,7-diol |
| SMILES | C/N=C1\C[C@H]2O[C@H](COCc3ccc(OC)cc3)[C@@H](O)[C@H](O)[C@H]2N1 |
| InChI | InChI=1S/C17H24N2O5/c1-18-14-7-12-15(19-14)17(21)16(20)13(24-12)9-23-8-10-3-5-11(22-2)6-4-10/h3-6,12-13,15-17,20-21H,7-9H2,1-2H3,(H,18,19)/t12-,13-,15+,16-,17-/m1/s1 |
| InChIKey | VFJRPNJWRVYBQA-MAURAIGZSA-N |
| XLogP | 0.09 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|