C9H6N6O2 — CID 137140030
4,9-diimino-5,8-dihydro-1H-imidazo[4,5-g]quinoxaline-6,7-dione (PubChem CID 137140030) has the molecular formula C9H6N6O2 and a molecular weight of 230.19 g/mol. Its IUPAC name is 4,9-diimino-5,8-dihydro-1H-imidazo[4,5-g]quinoxaline-6,7-dione.
| Compound Name | 4,9-diimino-5,8-dihydro-1H-imidazo[4,5-g]quinoxaline-6,7-dione |
|---|---|
| PubChem CID | 137140030 |
| Molecular Formula | C9H6N6O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4,9-diimino-5,8-dihydro-1H-imidazo[4,5-g]quinoxaline-6,7-dione |
| SMILES | [H]/N=C1\c2nc[nH]c2/C(=N\[H])c2[nH]c(=O)c(=O)[nH]c21 |
| InChI | InChI=1S/C9H6N6O2/c10-2-4-5(13-1-12-4)3(11)7-6(2)14-8(16)9(17)15-7/h1,10-11H,(H,12,13)(H,14,16)(H,15,17)/b10-2+,11-3+ |
| InChIKey | HWSFYDBTZWXBIT-NXOFHUPFSA-N |
| XLogP | -1.07 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|