C44H26N4O12S4-4 — CID 137225553
(3,5,7,8-tetraphenyl-17,18,20-trisulfinatooxy-22,24-dihydroporphyrin-2-yl) sulfite (PubChem CID 137225553) has the molecular formula C44H26N4O12S4-4 and a molecular weight of 930.98 g/mol. Its IUPAC name is (3,5,7,8-tetraphenyl-17,18,20-trisulfinatooxy-22,24-dihydroporphyrin-2-yl) sulfite.
| Compound Name | (3,5,7,8-tetraphenyl-17,18,20-trisulfinatooxy-22,24-dihydroporphyrin-2-yl) sulfite |
|---|---|
| PubChem CID | 137225553 |
| Molecular Formula | C44H26N4O12S4-4 |
| Molecular Weight | 930.98 g/mol |
| Exact Mass | 930.05 |
| IUPAC Name | (3,5,7,8-tetraphenyl-17,18,20-trisulfinatooxy-22,24-dihydroporphyrin-2-yl) sulfite |
| SMILES | O=S([O-])OC1=C(c2ccccc2)c2nc1c(OS(=O)[O-])c1[nH]c(cc3nc(cc4[nH]c(c2-c2ccccc2)c(-c2ccccc2)c4-c2ccccc2)C=C3)c(OS(=O)[O-])c1OS(=O)[O-] |
| InChI | InChI=1S/C44H30N4O12S4/c49-61(50)57-41-32-24-30-22-21-29(45-30)23-31-33(25-13-5-1-6-14-25)34(26-15-7-2-8-16-26)37(46-31)35(27-17-9-3-10-18-27)38-36(28-19-11-4-12-20-28)42(58-62(51)52)39(48-38)43(59-63(53)54)40(47-32)44(41)60-64(55)56/h1-24,46-47H,(H,49,50)(H,51,52)(H,53,54)(H,55,56)/p-4/b29-23-,30-24-,31-23-,32-24-,37-35-,38-35-,43-39+,43-40+ |
| InChIKey | XMTKABHDBFJQLX-UUNBRFEWSA-J |
| XLogP | 7.73 |
| TPSA | 254.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.98 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|