C14H12Br3NO2 — CID 137296823
2,6,8-tribromo-4-butylimino-5-hydroxynaphthalen-1-one (PubChem CID 137296823) has the molecular formula C14H12Br3NO2 and a molecular weight of 465.97 g/mol. Its IUPAC name is 2,6,8-tribromo-4-butylimino-5-hydroxynaphthalen-1-one.
| Compound Name | 2,6,8-tribromo-4-butylimino-5-hydroxynaphthalen-1-one |
|---|---|
| PubChem CID | 137296823 |
| Molecular Formula | C14H12Br3NO2 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 462.84 |
| IUPAC Name | 2,6,8-tribromo-4-butylimino-5-hydroxynaphthalen-1-one |
| SMILES | CCCC/N=C1\C=C(Br)C(=O)c2c(Br)cc(Br)c(O)c21 |
| InChI | InChI=1S/C14H12Br3NO2/c1-2-3-4-18-10-6-9(17)13(19)11-7(15)5-8(16)14(20)12(10)11/h5-6,20H,2-4H2,1H3/b18-10+ |
| InChIKey | ZIASXNQIRCCTST-VCHYOVAHSA-N |
| XLogP | 4.98 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|