C30H28Cl2N3O7S- — CID 137390344
(3R,4R)-4-carbamoyl-6-[2-carboxy-6-(hydroxymethyl)phenyl]-3-(2,4-dichlorophenyl)-1-oxo-2-[(1S,2S)-2-(sulfinatoamino)cyclohexyl]-3,4-dihydroisoquinoline (PubChem CID 137390344) has the molecular formula C30H28Cl2N3O7S- and a molecular weight of 645.54 g/mol. Its IUPAC name is (3R,4R)-4-carbamoyl-6-[2-carboxy-6-(hydroxymethyl)phenyl]-3-(2,4-dichlorophenyl)-1-oxo-2-[(1S,2S)-2-(sulfinatoamino)cyclohexyl]-3,4-dihydroisoquinoline.
| Compound Name | (3R,4R)-4-carbamoyl-6-[2-carboxy-6-(hydroxymethyl)phenyl]-3-(2,4-dichlorophenyl)-1-oxo-2-[(1S,2S)-2-(sulfinatoamino)cyclohexyl]-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 137390344 |
| Molecular Formula | C30H28Cl2N3O7S- |
| Molecular Weight | 645.54 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | (3R,4R)-4-carbamoyl-6-[2-carboxy-6-(hydroxymethyl)phenyl]-3-(2,4-dichlorophenyl)-1-oxo-2-[(1S,2S)-2-(sulfinatoamino)cyclohexyl]-3,4-dihydroisoquinoline |
| SMILES | NC(=O)[C@@H]1c2cc(-c3c(CO)cccc3C(=O)O)ccc2C(=O)N([C@H]2CCCC[C@@H]2NS(=O)[O-])[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H29Cl2N3O7S/c31-17-9-11-19(22(32)13-17)27-26(28(33)37)21-12-15(25-16(14-36)4-3-5-20(25)30(39)40)8-10-18(21)29(38)35(27)24-7-2-1-6-23(24)34-43(41)42/h3-5,8-13,23-24,26-27,34,36H,1-2,6-7,14H2,(H2,33,37)(H,39,40)(H,41,42)/p-1/t23-,24-,26+,27-/m0/s1 |
| InChIKey | VJCMGWYAMSBQNL-ATJLQDCWSA-M |
| XLogP | 4.31 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|