C22H27N5O4 — CID 137401718
N-[6-methoxy-9-[3-(3-methoxypropyl)-5-methyloxolan-2-yl]purin-2-yl]benzamide (PubChem CID 137401718) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[6-methoxy-9-[3-(3-methoxypropyl)-5-methyloxolan-2-yl]purin-2-yl]benzamide.
| Compound Name | N-[6-methoxy-9-[3-(3-methoxypropyl)-5-methyloxolan-2-yl]purin-2-yl]benzamide |
|---|---|
| PubChem CID | 137401718 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[6-methoxy-9-[3-(3-methoxypropyl)-5-methyloxolan-2-yl]purin-2-yl]benzamide |
| SMILES | COCCCC1CC(C)OC1n1cnc2c(OC)nc(NC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C22H27N5O4/c1-14-12-16(10-7-11-29-2)21(31-14)27-13-23-17-18(27)24-22(26-20(17)30-3)25-19(28)15-8-5-4-6-9-15/h4-6,8-9,13-14,16,21H,7,10-12H2,1-3H3,(H,24,25,26,28) |
| InChIKey | KFDXRXLPAWOGIH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|