About bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid
bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid (PubChem CID 137424422) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid |
| PubChem CID | 137424422 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid |
| SMILES | C1=C2CCC(C1)C2.O=C(O)C1CCCN1 |
| InChI | InChI=1S/C7H10.C5H9NO2/c1-2-7-4-3-6(1)5-7;7-5(8)4-2-1-3-6-4/h1,7H,2-5H2;4,6H,1-3H2,(H,7,8) |
| InChIKey | JASHAWSCIVXPNA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid (CID 137424422) is bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid is C1=C2CCC(C1)C2.O=C(O)C1CCCN1.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid?
The InChIKey is JASHAWSCIVXPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C5H9NO2/c1-2-7-4-3-6(1)5-7;7-5(8)4-2-1-3-6-4/h1,7H,2-5H2;4,6H,1-3H2,(H,7,8).
What are the key properties of bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid?
bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid has a molecular weight of 209.29 g/mol, XLogP of 1.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 137424422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).