C37H45N6O7+ — CID 138520925
[6-(diethylamino)-9-[2-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methylcarbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium (PubChem CID 138520925) has the molecular formula C37H45N6O7+ and a molecular weight of 685.80 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methylcarbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium.
| Compound Name | [6-(diethylamino)-9-[2-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methylcarbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 138520925 |
| Molecular Formula | C37H45N6O7+ |
| Molecular Weight | 685.80 g/mol |
| Exact Mass | 685.33 |
| IUPAC Name | [6-(diethylamino)-9-[2-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazol-4-yl]methylcarbamoyl]phenyl]xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)NCc3cn([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)nn3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C37H44N6O7/c1-5-41(6-2)23-13-15-27-29(17-23)49-30-18-24(42(7-3)8-4)14-16-28(30)32(27)25-11-9-10-12-26(25)36(48)38-19-22-20-43(40-39-22)37-35(47)34(46)33(45)31(21-44)50-37/h9-18,20,31,33-35,37,44-47H,5-8,19,21H2,1-4H3/p+1/t31-,33-,34+,35-,37-/m1/s1 |
| InChIKey | VTOABPVXKXBGNX-NVCDLKHVSA-O |
| XLogP | 2.36 |
| TPSA | 169.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.80 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|