C17H21N5O3 — CID 138572240
(2S,5R)-1-(imidazole-1-carbonyl)-5-(phenylmethoxyamino)piperidine-2-carboxamide (PubChem CID 138572240) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (2S,5R)-1-(imidazole-1-carbonyl)-5-(phenylmethoxyamino)piperidine-2-carboxamide.
| Compound Name | (2S,5R)-1-(imidazole-1-carbonyl)-5-(phenylmethoxyamino)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 138572240 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S,5R)-1-(imidazole-1-carbonyl)-5-(phenylmethoxyamino)piperidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1C(=O)n1ccnc1 |
| InChI | InChI=1S/C17H21N5O3/c18-16(23)15-7-6-14(20-25-11-13-4-2-1-3-5-13)10-22(15)17(24)21-9-8-19-12-21/h1-5,8-9,12,14-15,20H,6-7,10-11H2,(H2,18,23)/t14-,15+/m1/s1 |
| InChIKey | PIODHSUUFBGSDU-CABCVRRESA-N |
| XLogP | 0.89 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|