C10H23N3 — CID 138613345
(3R)-3-(2,3-dimethylpiperazin-1-yl)butan-2-amine (PubChem CID 138613345) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is (3R)-3-(2,3-dimethylpiperazin-1-yl)butan-2-amine.
| Compound Name | (3R)-3-(2,3-dimethylpiperazin-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 138613345 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | (3R)-3-(2,3-dimethylpiperazin-1-yl)butan-2-amine |
| SMILES | CC1NCCN([C@H](C)C(C)N)C1C |
| InChI | InChI=1S/C10H23N3/c1-7(11)9(3)13-6-5-12-8(2)10(13)4/h7-10,12H,5-6,11H2,1-4H3/t7?,8?,9-,10?/m1/s1 |
| InChIKey | PVRNPLYXKHUNAT-OWTMBLHMSA-N |
| XLogP | 0.40 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |