C24H24Cl4N2O3 — CID 138653684
2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-(2-oxohexan-3-yl)benzamide (PubChem CID 138653684) has the molecular formula C24H24Cl4N2O3 and a molecular weight of 530.28 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-(2-oxohexan-3-yl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-(2-oxohexan-3-yl)benzamide |
|---|---|
| PubChem CID | 138653684 |
| Molecular Formula | C24H24Cl4N2O3 |
| Molecular Weight | 530.28 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3-chloro-5-methylphenyl)cyclopropanecarbonyl]amino]-N-(2-oxohexan-3-yl)benzamide |
| SMILES | CCCC(NC(=O)c1cc(NC(=O)C2C(c3cc(C)cc(Cl)c3)C2(Cl)Cl)ccc1Cl)C(C)=O |
| InChI | InChI=1S/C24H24Cl4N2O3/c1-4-5-19(13(3)31)30-22(32)17-11-16(6-7-18(17)26)29-23(33)21-20(24(21,27)28)14-8-12(2)9-15(25)10-14/h6-11,19-21H,4-5H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | KGUOYGCDNZOEIN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.28 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|