C22H21NO3 — CID 138964833
(4Z,6E)-4-phenyl-9-oxa-2-azabicyclo[12.4.0]octadeca-1(18),4,6,14,16-pentaene-3,8-dione (PubChem CID 138964833) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (4Z,6E)-4-phenyl-9-oxa-2-azabicyclo[12.4.0]octadeca-1(18),4,6,14,16-pentaene-3,8-dione.
| Compound Name | (4Z,6E)-4-phenyl-9-oxa-2-azabicyclo[12.4.0]octadeca-1(18),4,6,14,16-pentaene-3,8-dione |
|---|---|
| PubChem CID | 138964833 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (4Z,6E)-4-phenyl-9-oxa-2-azabicyclo[12.4.0]octadeca-1(18),4,6,14,16-pentaene-3,8-dione |
| SMILES | O=C1/C=C/C=C(/c2ccccc2)C(=O)Nc2ccccc2CCCCO1 |
| InChI | InChI=1S/C22H21NO3/c24-21-15-8-13-19(17-9-2-1-3-10-17)22(25)23-20-14-5-4-11-18(20)12-6-7-16-26-21/h1-5,8-11,13-15H,6-7,12,16H2,(H,23,25)/b15-8+,19-13- |
| InChIKey | FLDAWLORMJOURR-HHPWFJCQSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |