C12H10O2S2 — CID 139055017
(1R,4R)-2,3-dihydrobenzo[h][1,4]benzodithiine 1,4-dioxide (PubChem CID 139055017) has the molecular formula C12H10O2S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,4R)-2,3-dihydrobenzo[h][1,4]benzodithiine 1,4-dioxide.
| Compound Name | (1R,4R)-2,3-dihydrobenzo[h][1,4]benzodithiine 1,4-dioxide |
|---|---|
| PubChem CID | 139055017 |
| Molecular Formula | C12H10O2S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | (1R,4R)-2,3-dihydrobenzo[h][1,4]benzodithiine 1,4-dioxide |
| SMILES | O=[S@@]1CC[S@@](=O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C12H10O2S2/c13-15-7-8-16(14)12-10-4-2-1-3-9(10)5-6-11(12)15/h1-6H,7-8H2/t15-,16-/m1/s1 |
| InChIKey | TWJHYRJFDQCQMZ-HZPDHXFCSA-N |
| XLogP | 2.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |