C19H18O — CID 139122076
(4aR,8S,12bR)-8-ethenyl-4,4a,7,8-tetrahydro-3H-indeno[3a,3-a]naphthalen-5-one (PubChem CID 139122076) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is (4aR,8S,12bR)-8-ethenyl-4,4a,7,8-tetrahydro-3H-indeno[3a,3-a]naphthalen-5-one.
| Compound Name | (4aR,8S,12bR)-8-ethenyl-4,4a,7,8-tetrahydro-3H-indeno[3a,3-a]naphthalen-5-one |
|---|---|
| PubChem CID | 139122076 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (4aR,8S,12bR)-8-ethenyl-4,4a,7,8-tetrahydro-3H-indeno[3a,3-a]naphthalen-5-one |
| SMILES | C=C[C@@H]1CC2=CC(=O)[C@@H]3CCC=C[C@]23c2ccccc21 |
| InChI | InChI=1S/C19H18O/c1-2-13-11-14-12-18(20)17-9-5-6-10-19(14,17)16-8-4-3-7-15(13)16/h2-4,6-8,10,12-13,17H,1,5,9,11H2/t13-,17+,19-/m1/s1 |
| InChIKey | VDALYTZVYBLHSW-XVGQJIODSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|