C59H61N3P2 — CID 139124421
(1S)-2,7-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-N-(2,6-dimethylphenyl)-2,7-diaza-1,4-diphosphabicyclo[2.2.1]hept-5-en-3-imine (PubChem CID 139124421) has the molecular formula C59H61N3P2 and a molecular weight of 874.11 g/mol. Its IUPAC name is (1S)-2,7-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-N-(2,6-dimethylphenyl)-2,7-diaza-1,4-diphosphabicyclo[2.2.1]hept-5-en-3-imine.
| Compound Name | (1S)-2,7-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-N-(2,6-dimethylphenyl)-2,7-diaza-1,4-diphosphabicyclo[2.2.1]hept-5-en-3-imine |
|---|---|
| PubChem CID | 139124421 |
| Molecular Formula | C59H61N3P2 |
| Molecular Weight | 874.11 g/mol |
| Exact Mass | 873.43 |
| IUPAC Name | (1S)-2,7-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-N-(2,6-dimethylphenyl)-2,7-diaza-1,4-diphosphabicyclo[2.2.1]hept-5-en-3-imine |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2N2/C(=N/c3c(C)cccc3C)P3C=C[P@@]2N3c2c(-c3c(C)cc(C)cc3C)cccc2-c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C59H61N3P2/c1-34-26-40(7)52(41(8)27-34)48-20-16-21-49(53-42(9)28-35(2)29-43(53)10)57(48)61-59(60-56-38(5)18-15-19-39(56)6)63-24-25-64(61)62(63)58-50(54-44(11)30-36(3)31-45(54)12)22-17-23-51(58)55-46(13)32-37(4)33-47(55)14/h15-33H,1-14H3/b60-59-/t63?,64-/m1/s1 |
| InChIKey | UIYZMIADLATLQR-WGMDGTOKSA-N |
| XLogP | 17.88 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.11 |
| LogP ≤ 5 | 17.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|