C25H27I2N3P2 — CID 122211610
N,1,3-tris(2,6-dimethylphenyl)-2,4-diiodo-1,3,2,4-diazadiphospholidin-5-imine (PubChem CID 122211610) has the molecular formula C25H27I2N3P2 and a molecular weight of 685.27 g/mol. Its IUPAC name is N,1,3-tris(2,6-dimethylphenyl)-2,4-diiodo-1,3,2,4-diazadiphospholidin-5-imine.
| Compound Name | N,1,3-tris(2,6-dimethylphenyl)-2,4-diiodo-1,3,2,4-diazadiphospholidin-5-imine |
|---|---|
| PubChem CID | 122211610 |
| Molecular Formula | C25H27I2N3P2 |
| Molecular Weight | 685.27 g/mol |
| Exact Mass | 684.98 |
| IUPAC Name | N,1,3-tris(2,6-dimethylphenyl)-2,4-diiodo-1,3,2,4-diazadiphospholidin-5-imine |
| SMILES | Cc1cccc(C)c1/N=C1/N(c2c(C)cccc2C)P(I)N(c2c(C)cccc2C)P1I |
| InChI | InChI=1S/C25H27I2N3P2/c1-16-10-7-11-17(2)22(16)28-25-29(23-18(3)12-8-13-19(23)4)32(27)30(31(25)26)24-20(5)14-9-15-21(24)6/h7-15H,1-6H3/b28-25- |
| InChIKey | JPSIBXJGXYZTLU-FVDSYPCUSA-N |
| XLogP | 9.96 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.27 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|