C68H69BF15O3P — CID 139157507
tris(2,3,4,5,6-pentafluorophenyl)-[(E)-2-phenyl-2-tris(2,4-ditert-butylphenoxy)phosphaniumylethenyl]boranuide (PubChem CID 139157507) has the molecular formula C68H69BF15O3P and a molecular weight of 1261.05 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-[(E)-2-phenyl-2-tris(2,4-ditert-butylphenoxy)phosphaniumylethenyl]boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-[(E)-2-phenyl-2-tris(2,4-ditert-butylphenoxy)phosphaniumylethenyl]boranuide |
|---|---|
| PubChem CID | 139157507 |
| Molecular Formula | C68H69BF15O3P |
| Molecular Weight | 1261.05 g/mol |
| Exact Mass | 1260.48 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-[(E)-2-phenyl-2-tris(2,4-ditert-butylphenoxy)phosphaniumylethenyl]boranuide |
| SMILES | CC(C)(C)c1ccc(O[P+](Oc2ccc(C(C)(C)C)cc2C(C)(C)C)(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)/C(=C/[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H69BF15O3P/c1-63(2,3)35-24-27-41(38(30-35)66(10,11)12)85-88(86-42-28-25-36(64(4,5)6)31-39(42)67(13,14)15,87-43-29-26-37(65(7,8)9)32-40(43)68(16,17)18)44(34-22-20-19-21-23-34)33-69(45-48(70)54(76)60(82)55(77)49(45)71,46-50(72)56(78)61(83)57(79)51(46)73)47-52(74)58(80)62(84)59(81)53(47)75/h19-33H,1-18H3/b44-33+ |
| InChIKey | BAFWWEZPPQAHLZ-HCAAEISRSA-N |
| XLogP | 19.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1261.05 |
| LogP ≤ 5 | 19.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|