C7H13Br3N2 — CID 139188827
bromoform;1,4-diazabicyclo[2.2.2]octane (PubChem CID 139188827) has the molecular formula C7H13Br3N2 and a molecular weight of 364.91 g/mol. Its IUPAC name is bromoform;1,4-diazabicyclo[2.2.2]octane.
| Compound Name | bromoform;1,4-diazabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 139188827 |
| Molecular Formula | C7H13Br3N2 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 361.86 |
| IUPAC Name | bromoform;1,4-diazabicyclo[2.2.2]octane |
| SMILES | BrC(Br)Br.C1CN2CCN1CC2 |
| InChI | InChI=1S/C6H12N2.CHBr3/c1-2-8-5-3-7(1)4-6-8;2-1(3)4/h1-6H2;1H |
| InChIKey | PIBPEYUJLOEUHG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|