C35H27BF10NOP — CID 139204956
bis(2,4,6-trimethylphenyl)phosphanyloxy-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide (PubChem CID 139204956) has the molecular formula C35H27BF10NOP and a molecular weight of 709.37 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)phosphanyloxy-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide.
| Compound Name | bis(2,4,6-trimethylphenyl)phosphanyloxy-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139204956 |
| Molecular Formula | C35H27BF10NOP |
| Molecular Weight | 709.37 g/mol |
| Exact Mass | 709.18 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)phosphanyloxy-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
| SMILES | Cc1cc(C)c(P(O[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[n+]2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C35H27BF10NOP/c1-16-12-18(3)34(19(4)13-16)49(35-20(5)14-17(2)15-21(35)6)48-36(47-10-8-7-9-11-47,22-24(37)28(41)32(45)29(42)25(22)38)23-26(39)30(43)33(46)31(44)27(23)40/h7-15H,1-6H3 |
| InChIKey | CDVMURTUVXYBIH-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.37 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|