C12H5F3N2O4 — CID 139223114
2,2,2-trifluoro-N-(4-oxochromeno[3,4-d][1,2]oxazol-3-yl)acetamide (PubChem CID 139223114) has the molecular formula C12H5F3N2O4 and a molecular weight of 298.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-oxochromeno[3,4-d][1,2]oxazol-3-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-oxochromeno[3,4-d][1,2]oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 139223114 |
| Molecular Formula | C12H5F3N2O4 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-oxochromeno[3,4-d][1,2]oxazol-3-yl)acetamide |
| SMILES | O=C(Nc1noc2c1c(=O)oc1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C12H5F3N2O4/c13-12(14,15)11(19)16-9-7-8(21-17-9)5-3-1-2-4-6(5)20-10(7)18/h1-4H,(H,16,17,19) |
| InChIKey | UWSCZCODJLPIIY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|