C10H7F3N2O4 — CID 67409455
[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamic acid (PubChem CID 67409455) has the molecular formula C10H7F3N2O4 and a molecular weight of 276.17 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamic acid.
| Compound Name | [4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67409455 |
| Molecular Formula | C10H7F3N2O4 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamic acid |
| SMILES | O=C(O)Nc1noc2cccc(OCC(F)(F)F)c12 |
| InChI | InChI=1S/C10H7F3N2O4/c11-10(12,13)4-18-5-2-1-3-6-7(5)8(15-19-6)14-9(16)17/h1-3H,4H2,(H,14,15)(H,16,17) |
| InChIKey | LGQMFLXQCAGNPZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |