C18H20N2O2S — CID 139228443
(3R,3aS,9bS)-1,5-dimethyl-3-phenyl-2,3,3a,9b-tetrahydropyrrolo[3,2-c][2,1]benzothiazine 4,4-dioxide (PubChem CID 139228443) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is (3R,3aS,9bS)-1,5-dimethyl-3-phenyl-2,3,3a,9b-tetrahydropyrrolo[3,2-c][2,1]benzothiazine 4,4-dioxide.
| Compound Name | (3R,3aS,9bS)-1,5-dimethyl-3-phenyl-2,3,3a,9b-tetrahydropyrrolo[3,2-c][2,1]benzothiazine 4,4-dioxide |
|---|---|
| PubChem CID | 139228443 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (3R,3aS,9bS)-1,5-dimethyl-3-phenyl-2,3,3a,9b-tetrahydropyrrolo[3,2-c][2,1]benzothiazine 4,4-dioxide |
| SMILES | CN1C[C@@H](c2ccccc2)[C@H]2[C@@H]1c1ccccc1N(C)S2(=O)=O |
| InChI | InChI=1S/C18H20N2O2S/c1-19-12-15(13-8-4-3-5-9-13)18-17(19)14-10-6-7-11-16(14)20(2)23(18,21)22/h3-11,15,17-18H,12H2,1-2H3/t15-,17-,18-/m0/s1 |
| InChIKey | ASWVCPHNOFCLQP-SZMVWBNQSA-N |
| XLogP | 2.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |