C21H15F6NOS2 — CID 139229276
4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-2-phenyl-1,3-thiazole (PubChem CID 139229276) has the molecular formula C21H15F6NOS2 and a molecular weight of 475.48 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-2-phenyl-1,3-thiazole.
| Compound Name | 4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 139229276 |
| Molecular Formula | C21H15F6NOS2 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxy-2-phenyl-1,3-thiazole |
| SMILES | COc1sc(-c2ccccc2)nc1C1=C(c2cc(C)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H15F6NOS2/c1-10-9-13(11(2)30-10)14-15(20(24,25)21(26,27)19(14,22)23)16-18(29-3)31-17(28-16)12-7-5-4-6-8-12/h4-9H,1-3H3 |
| InChIKey | IACNGSNHDUBKQL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|