C36H32BF2N5 — CID 139250074
4-[1-difluoroboranyl-5-[(Z)-[5-[4-(dimethylamino)phenyl]-3-phenylpyrrol-2-ylidene]amino]-4-phenylpyrrol-2-yl]-N,N-dimethylaniline (PubChem CID 139250074) has the molecular formula C36H32BF2N5 and a molecular weight of 583.50 g/mol. Its IUPAC name is 4-[1-difluoroboranyl-5-[(Z)-[5-[4-(dimethylamino)phenyl]-3-phenylpyrrol-2-ylidene]amino]-4-phenylpyrrol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-difluoroboranyl-5-[(Z)-[5-[4-(dimethylamino)phenyl]-3-phenylpyrrol-2-ylidene]amino]-4-phenylpyrrol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139250074 |
| Molecular Formula | C36H32BF2N5 |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 4-[1-difluoroboranyl-5-[(Z)-[5-[4-(dimethylamino)phenyl]-3-phenylpyrrol-2-ylidene]amino]-4-phenylpyrrol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2=N/C(=N\c3c(-c4ccccc4)cc(-c4ccc(N(C)C)cc4)n3B(F)F)C(c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C36H32BF2N5/c1-42(2)29-19-15-27(16-20-29)33-23-31(25-11-7-5-8-12-25)35(40-33)41-36-32(26-13-9-6-10-14-26)24-34(44(36)37(38)39)28-17-21-30(22-18-28)43(3)4/h5-24H,1-4H3/b41-35- |
| InChIKey | NOHLEGMGYYRZQA-LCNSVZBRSA-N |
| XLogP | 8.34 |
| TPSA | 36.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|