C23H32N2O10 — CID 139325672
propan-2-yl (2S)-2-[[4-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxycarbonylamino]-6-imino-5-oxohexanoate (PubChem CID 139325672) has the molecular formula C23H32N2O10 and a molecular weight of 496.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[4-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxycarbonylamino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[4-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxycarbonylamino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 139325672 |
| Molecular Formula | C23H32N2O10 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[4-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxycarbonylamino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)OCc1ccc(O[C@@H]2C[C@@H](O)[C@@H](O)[C@@H](CO)O2)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C23H32N2O10/c1-13(2)33-22(30)17(8-5-15(27)10-24)25-23(31)32-12-14-3-6-16(7-4-14)34-20-9-18(28)21(29)19(11-26)35-20/h3-4,6-7,10,13,17-21,24,26,28-29H,5,8-9,11-12H2,1-2H3,(H,25,31)/b24-10+/t17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | YVTITXRYNXFKEL-GBOPXECYSA-N |
| XLogP | 0.44 |
| TPSA | 184.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|