C13H15BrFN7O4 — CID 139339344
2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanamide (PubChem CID 139339344) has the molecular formula C13H15BrFN7O4 and a molecular weight of 432.21 g/mol. Its IUPAC name is 2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanamide.
| Compound Name | 2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanamide |
|---|---|
| PubChem CID | 139339344 |
| Molecular Formula | C13H15BrFN7O4 |
| Molecular Weight | 432.21 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-amino-4-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]oxybutanamide |
| SMILES | NC(=O)C(N)CCONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C13H15BrFN7O4/c14-7-5-6(1-2-8(7)15)18-12(19-24)10-13(22-26-20-10)21-25-4-3-9(16)11(17)23/h1-2,5,9,24H,3-4,16H2,(H2,17,23)(H,18,19)(H,21,22) |
| InChIKey | LJYMAGDAKUCFJC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 173.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|