C35H55N3O2S — CID 139404924
N-(2,6-dimethylphenyl)-2-[2-[[[4-(2,6-dimethylphenyl)-2-oxobutyl]-octylamino]methylsulfanyl]ethyl-ethylamino]acetamide (PubChem CID 139404924) has the molecular formula C35H55N3O2S and a molecular weight of 581.91 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[2-[[[4-(2,6-dimethylphenyl)-2-oxobutyl]-octylamino]methylsulfanyl]ethyl-ethylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[2-[[[4-(2,6-dimethylphenyl)-2-oxobutyl]-octylamino]methylsulfanyl]ethyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 139404924 |
| Molecular Formula | C35H55N3O2S |
| Molecular Weight | 581.91 g/mol |
| Exact Mass | 581.40 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[2-[[[4-(2,6-dimethylphenyl)-2-oxobutyl]-octylamino]methylsulfanyl]ethyl-ethylamino]acetamide |
| SMILES | CCCCCCCCN(CSCCN(CC)CC(=O)Nc1c(C)cccc1C)CC(=O)CCc1c(C)cccc1C |
| InChI | InChI=1S/C35H55N3O2S/c1-7-9-10-11-12-13-22-38(25-32(39)20-21-33-28(3)16-14-17-29(33)4)27-41-24-23-37(8-2)26-34(40)36-35-30(5)18-15-19-31(35)6/h14-19H,7-13,20-27H2,1-6H3,(H,36,40) |
| InChIKey | YJBQFPCZRKFEHL-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.91 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|