C30H33Cl2NO — CID 139524271
6-[(3Z,5Z)-2,3-dichlorohepta-1,3,5-trien-4-yl]oxy-2-[4-[(1S)-1-methyl-2-propyl-1,3-dihydroinden-2-yl]but-1-en-2-yl]-1-azacyclohepta-2,4,5,7-tetraene (PubChem CID 139524271) has the molecular formula C30H33Cl2NO and a molecular weight of 494.51 g/mol. Its IUPAC name is 6-[(3Z,5Z)-2,3-dichlorohepta-1,3,5-trien-4-yl]oxy-2-[4-[(1S)-1-methyl-2-propyl-1,3-dihydroinden-2-yl]but-1-en-2-yl]-1-azacyclohepta-2,4,5,7-tetraene.
| Compound Name | 6-[(3Z,5Z)-2,3-dichlorohepta-1,3,5-trien-4-yl]oxy-2-[4-[(1S)-1-methyl-2-propyl-1,3-dihydroinden-2-yl]but-1-en-2-yl]-1-azacyclohepta-2,4,5,7-tetraene |
|---|---|
| PubChem CID | 139524271 |
| Molecular Formula | C30H33Cl2NO |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 6-[(3Z,5Z)-2,3-dichlorohepta-1,3,5-trien-4-yl]oxy-2-[4-[(1S)-1-methyl-2-propyl-1,3-dihydroinden-2-yl]but-1-en-2-yl]-1-azacyclohepta-2,4,5,7-tetraene |
| SMILES | C=C(CCC1(CCC)Cc2ccccc2[C@H]1C)C1=CC=C=C(OC(/C=C\C)=C(\Cl)C(=C)Cl)C=N1 |
| InChI | InChI=1S/C30H33Cl2NO/c1-6-11-28(29(32)23(5)31)34-25-13-10-15-27(33-20-25)21(3)16-18-30(17-7-2)19-24-12-8-9-14-26(24)22(30)4/h6,8-12,14-15,20,22H,3,5,7,16-19H2,1-2,4H3/b11-6-,29-28-/t22-,30?/m1/s1 |
| InChIKey | KSRINNGNSUFRJR-COBQPPBMSA-N |
| XLogP | 9.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|