C13H16O10 — CID 139600039
[(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl] 2-deuterio-3,4,5-trihydroxybenzoate (PubChem CID 139600039) has the molecular formula C13H16O10 and a molecular weight of 333.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl] 2-deuterio-3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl] 2-deuterio-3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 139600039 |
| Molecular Formula | C13H16O10 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl] 2-deuterio-3,4,5-trihydroxybenzoate |
| SMILES | [2H]c1c(C(=O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)C=O)cc(O)c(O)c1O |
| InChI | InChI=1S/C13H16O10/c14-3-8(18)11(21)12(9(19)4-15)23-13(22)5-1-6(16)10(20)7(17)2-5/h1-2,4,8-9,11-12,14,16-21H,3H2/t8-,9+,11-,12-/m1/s1/i1D |
| InChIKey | DUPUAYOTOWVLFB-HQJYJMAKSA-N |
| XLogP | -2.40 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|