C17H17BClFO3 — CID 139617376
2-[4-(4-chloro-3-fluorophenyl)phenyl]-5-ethoxy-1,3,2-dioxaborinane (PubChem CID 139617376) has the molecular formula C17H17BClFO3 and a molecular weight of 334.58 g/mol. Its IUPAC name is 2-[4-(4-chloro-3-fluorophenyl)phenyl]-5-ethoxy-1,3,2-dioxaborinane.
| Compound Name | 2-[4-(4-chloro-3-fluorophenyl)phenyl]-5-ethoxy-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139617376 |
| Molecular Formula | C17H17BClFO3 |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[4-(4-chloro-3-fluorophenyl)phenyl]-5-ethoxy-1,3,2-dioxaborinane |
| SMILES | CCOC1COB(c2ccc(-c3ccc(Cl)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C17H17BClFO3/c1-2-21-15-10-22-18(23-11-15)14-6-3-12(4-7-14)13-5-8-16(19)17(20)9-13/h3-9,15H,2,10-11H2,1H3 |
| InChIKey | GONMUHBBEZINNK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|