C28H36N2O2S — CID 139636963
4-[[4-(dimethylamino)phenyl]-(4-methylphenyl)sulfonylmethyl]-N,N,3-triethylaniline (PubChem CID 139636963) has the molecular formula C28H36N2O2S and a molecular weight of 464.68 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-(4-methylphenyl)sulfonylmethyl]-N,N,3-triethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-(4-methylphenyl)sulfonylmethyl]-N,N,3-triethylaniline |
|---|---|
| PubChem CID | 139636963 |
| Molecular Formula | C28H36N2O2S |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-(4-methylphenyl)sulfonylmethyl]-N,N,3-triethylaniline |
| SMILES | CCc1cc(N(CC)CC)ccc1C(c1ccc(N(C)C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H36N2O2S/c1-7-22-20-25(30(8-2)9-3)16-19-27(22)28(23-12-14-24(15-13-23)29(5)6)33(31,32)26-17-10-21(4)11-18-26/h10-20,28H,7-9H2,1-6H3 |
| InChIKey | HITNJDGOZABFOR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|