C16H18ClNO8S — CID 139695118
3-(2-chloro-3-methoxy-4-methylsulfonylbenzoyl)-6-(hydroxymethyl)-1-methoxypiperidine-2,4-dione (PubChem CID 139695118) has the molecular formula C16H18ClNO8S and a molecular weight of 419.84 g/mol. Its IUPAC name is 3-(2-chloro-3-methoxy-4-methylsulfonylbenzoyl)-6-(hydroxymethyl)-1-methoxypiperidine-2,4-dione.
| Compound Name | 3-(2-chloro-3-methoxy-4-methylsulfonylbenzoyl)-6-(hydroxymethyl)-1-methoxypiperidine-2,4-dione |
|---|---|
| PubChem CID | 139695118 |
| Molecular Formula | C16H18ClNO8S |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 3-(2-chloro-3-methoxy-4-methylsulfonylbenzoyl)-6-(hydroxymethyl)-1-methoxypiperidine-2,4-dione |
| SMILES | COc1c(S(C)(=O)=O)ccc(C(=O)C2C(=O)CC(CO)N(OC)C2=O)c1Cl |
| InChI | InChI=1S/C16H18ClNO8S/c1-25-15-11(27(3,23)24)5-4-9(13(15)17)14(21)12-10(20)6-8(7-19)18(26-2)16(12)22/h4-5,8,12,19H,6-7H2,1-3H3 |
| InChIKey | JHRRJNHBSMPZMK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|