C44H49BBr6O7S2 — CID 139752669
bis[bis(2-hydroxyethyl)-[(2,4,6-tribromophenyl)methyl]-λ4-sulfanyl] 4,4,4-triphenylbutyl borate (PubChem CID 139752669) has the molecular formula C44H49BBr6O7S2 and a molecular weight of 1244.24 g/mol. Its IUPAC name is bis[bis(2-hydroxyethyl)-[(2,4,6-tribromophenyl)methyl]-λ4-sulfanyl] 4,4,4-triphenylbutyl borate.
| Compound Name | bis[bis(2-hydroxyethyl)-[(2,4,6-tribromophenyl)methyl]-λ4-sulfanyl] 4,4,4-triphenylbutyl borate |
|---|---|
| PubChem CID | 139752669 |
| Molecular Formula | C44H49BBr6O7S2 |
| Molecular Weight | 1244.24 g/mol |
| Exact Mass | 1237.81 |
| IUPAC Name | bis[bis(2-hydroxyethyl)-[(2,4,6-tribromophenyl)methyl]-λ4-sulfanyl] 4,4,4-triphenylbutyl borate |
| SMILES | OCCS(CCO)(Cc1c(Br)cc(Br)cc1Br)OB(OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1)OS(CCO)(CCO)Cc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C44H49BBr6O7S2/c46-36-27-40(48)38(41(49)28-36)31-59(23-18-52,24-19-53)57-45(58-60(25-20-54,26-21-55)32-39-42(50)29-37(47)30-43(39)51)56-22-10-17-44(33-11-4-1-5-12-33,34-13-6-2-7-14-34)35-15-8-3-9-16-35/h1-9,11-16,27-30,52-55H,10,17-26,31-32H2 |
| InChIKey | USJPKIDRHJWIMH-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1244.24 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|