C13H12F2N2O4S3 — CID 139809238
3-(2,4-difluorophenyl)sulfanyl-N'-methylsulfonylbenzenesulfonohydrazide (PubChem CID 139809238) has the molecular formula C13H12F2N2O4S3 and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfanyl-N'-methylsulfonylbenzenesulfonohydrazide.
| Compound Name | 3-(2,4-difluorophenyl)sulfanyl-N'-methylsulfonylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 139809238 |
| Molecular Formula | C13H12F2N2O4S3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfanyl-N'-methylsulfonylbenzenesulfonohydrazide |
| SMILES | CS(=O)(=O)NNS(=O)(=O)c1cccc(Sc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H12F2N2O4S3/c1-23(18,19)16-17-24(20,21)11-4-2-3-10(8-11)22-13-6-5-9(14)7-12(13)15/h2-8,16-17H,1H3 |
| InChIKey | WAKBDARCLWTVOF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|