C26H30O5 — CID 139884870
4-[5-[5-(3,4-dimethoxyphenyl)pent-2-ynoxy]pent-3-ynyl]-1,2-dimethoxybenzene (PubChem CID 139884870) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 4-[5-[5-(3,4-dimethoxyphenyl)pent-2-ynoxy]pent-3-ynyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[5-[5-(3,4-dimethoxyphenyl)pent-2-ynoxy]pent-3-ynyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 139884870 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-[5-[5-(3,4-dimethoxyphenyl)pent-2-ynoxy]pent-3-ynyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CCC#CCOCC#CCCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H30O5/c1-27-23-15-13-21(19-25(23)29-3)11-7-5-9-17-31-18-10-6-8-12-22-14-16-24(28-2)26(20-22)30-4/h13-16,19-20H,7-8,11-12,17-18H2,1-4H3 |
| InChIKey | QCSKUUIMTCBCLV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|