C13H18NO3+ — CID 153340180
3-(3,4-dimethoxyphenyl)-N-ethoxypropanenitrilium (PubChem CID 153340180) has the molecular formula C13H18NO3+ and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-ethoxypropanenitrilium.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-ethoxypropanenitrilium |
|---|---|
| PubChem CID | 153340180 |
| Molecular Formula | C13H18NO3+ |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-ethoxypropanenitrilium |
| SMILES | CCO[N+]#CCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18NO3/c1-4-17-14-9-5-6-11-7-8-12(15-2)13(10-11)16-3/h7-8,10H,4-6H2,1-3H3/q+1 |
| InChIKey | MUKDEQRALHEOJD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|